AhmariB234521 AhmariB234521

03-11-2022
Mathematics

contestada

There were 24 dinner tables with 8 chairs at each table.Each dinner ticket cost $12.50. If 3/4 of thr dinner tables were full,how much money was raised from the dinner ticket sales?

Respuesta :

LarsenC24637 LarsenC24637

03-11-2022

we have the next information

24 dinner tables

each has 8 chairs

First we need to calculate 3/4 of the tables

24 mesas ----- 4/4=1

x ----- 3/4

x = the number of tabl

Answer Link

Otras preguntas

Each place in a decimal number can be one of the digits 0 to 9. Each place in a binary number can only be 0 or 1. The table shows the number of digits needed to

cosec(6b+pi/8)=sec(2b-pi/8)

Determine whether the pair of lines is parallel,perpendicular or neither y=3x+2 , y=-3x-1

What details of Thomas Coles work made him or her an interesting historical figure?

Match each description with the correct form of energy. 1. energy of an object's position above the ground. 2. stored in the bonds of atoms and molecules 3. sto

Please answer soon! I will mark brainiest!

If a device does not require a driver, it is _____. A quickset B plug and play C hyperconnected

3/4 of the class like dogs. 1/6 of the class like cats. what fraction of the class like either cats or dogs?

12x1 12x2 12x3 12x4 djdjdjjfjfir

Mrs. Zerlinsky wrote a chemical equation on the board and asked her class what should be changed to make it correct. She wrote: water + glucose → carbon dioxi