sklnood sklnood

01-04-2020
English

contestada

Type the prepositional phrase, the preposition, and the object of the preposition in the sentence below.

The fish swam around the boat.

Respuesta :

calypso59 calypso59

02-04-2020

Answer:

preposition: around. prepositional phrase: around the boat. object of preposition: boat

Answer Link

Otras preguntas

A rod on a compressed spring exerts 12 N of force on a 0.05-kg steel ball. The rod pushes the ball 0.03 m. How much work does the spring do on the ball? A) 36 B

What improves the structured approach in design? A team is adopting a structured approach in design which helps them to improve the ___ of the design.

Cecilia is observing assembly line workers performing their tasks. She's watching to see who they interact with, what machines they use, and how much they are s

In which two sentences do the words in parenthesis represent prepositional phrases? -(The man in the house) seemed to be asleep. -The soldiers crept cautiously

Factor quadratic plz 15x^2-4x-4=

Name the following compound from the concise formula:______. CH3CH(CH3)CHCHCH(CH3)CH2CH3 A. 2,4-dimethyl-3-heptene B. 2,5-dimethyl-3-heptene C. 3,5-dimethyl

Imagine you want to use conflict in a positive way. You decide to create a sense of competition among your team members. Which of these tactics could create com

PLZ HELPPPPPP. A store sells books for $12 each. In the proportional relationship between x, the number of books purchased, and y, the cost per books in dollars

If the probability that a person will die in the next year is 771/100,000 what is the probability that the person will not die in the next year? A. 0.771% B. 99

You purchased a stock at a price of $46.55. The stock paid a dividend of $1.79 per share and the stock price at the end of the year is $52.45. What was the divi